C17H33NO2Si — CID 10892321
[(R)-cyclohexen-1-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate (PubChem CID 10892321) has the molecular formula C17H33NO2Si and a molecular weight of 311.54 g/mol. Its IUPAC name is [(R)-cyclohexen-1-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | [(R)-cyclohexen-1-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 10892321 |
| Molecular Formula | C17H33NO2Si |
| Molecular Weight | 311.54 g/mol |
| Exact Mass | 311.23 |
| IUPAC Name | [(R)-cyclohexen-1-yl(trimethylsilyl)methyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)O[C@@H](C1=CCCCC1)[Si](C)(C)C)C(C)C |
| InChI | InChI=1S/C17H33NO2Si/c1-13(2)18(14(3)4)17(19)20-16(21(5,6)7)15-11-9-8-10-12-15/h11,13-14,16H,8-10,12H2,1-7H3/t16-/m1/s1 |
| InChIKey | DMLODPAZOALREF-MRXNPFEDSA-N |
| XLogP | 4.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.54 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|