C19H24CrN2O6 — CID 134899208
carbon monoxide;chromium;[2-(dimethylcarbamoyl)phenyl] N,N-di(propan-2-yl)carbamate (PubChem CID 134899208) has the molecular formula C19H24CrN2O6 and a molecular weight of 428.41 g/mol. Its IUPAC name is carbon monoxide;chromium;[2-(dimethylcarbamoyl)phenyl] N,N-di(propan-2-yl)carbamate.
| Compound Name | carbon monoxide;chromium;[2-(dimethylcarbamoyl)phenyl] N,N-di(propan-2-yl)carbamate |
|---|---|
| PubChem CID | 134899208 |
| Molecular Formula | C19H24CrN2O6 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | carbon monoxide;chromium;[2-(dimethylcarbamoyl)phenyl] N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)Oc1ccccc1C(=O)N(C)C)C(C)C.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C16H24N2O3.3CO.Cr/c1-11(2)18(12(3)4)16(20)21-14-10-8-7-9-13(14)15(19)17(5)6;3*1-2;/h7-12H,1-6H3;;;; |
| InChIKey | MCLKTFXTMUWPAK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 109.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|