C40H48O6 — CID 58586901
[7-(4-hexylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate (PubChem CID 58586901) has the molecular formula C40H48O6 and a molecular weight of 624.82 g/mol. Its IUPAC name is [7-(4-hexylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate.
| Compound Name | [7-(4-hexylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate |
|---|---|
| PubChem CID | 58586901 |
| Molecular Formula | C40H48O6 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | [7-(4-hexylcyclohexanecarbonyl)oxy-9H-fluoren-2-yl] 4-[5-(oxiran-2-yl)pentoxy]benzoate |
| SMILES | CCCCCCC1CCC(C(=O)Oc2ccc3c(c2)Cc2cc(OC(=O)c4ccc(OCCCCCC5CO5)cc4)ccc2-3)CC1 |
| InChI | InChI=1S/C40H48O6/c1-2-3-4-6-9-28-11-13-29(14-12-28)39(41)45-34-19-21-37-31(25-34)24-32-26-35(20-22-38(32)37)46-40(42)30-15-17-33(18-16-30)43-23-8-5-7-10-36-27-44-36/h15-22,25-26,28-29,36H,2-14,23-24,27H2,1H3 |
| InChIKey | HTCTYBUCYKRLTR-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|