C39H54O8 — CID 169055155
[4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[2-(6-hydroxyhexanoyloxy)ethoxy]benzoate (PubChem CID 169055155) has the molecular formula C39H54O8 and a molecular weight of 650.85 g/mol. Its IUPAC name is [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[2-(6-hydroxyhexanoyloxy)ethoxy]benzoate.
| Compound Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[2-(6-hydroxyhexanoyloxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 169055155 |
| Molecular Formula | C39H54O8 |
| Molecular Weight | 650.85 g/mol |
| Exact Mass | 650.38 |
| IUPAC Name | [4-[4-(4-pentylcyclohexyl)cyclohexanecarbonyl]oxyphenyl] 4-[2-(6-hydroxyhexanoyloxy)ethoxy]benzoate |
| SMILES | CCCCCC1CCC(C2CCC(C(=O)Oc3ccc(OC(=O)c4ccc(OCCOC(=O)CCCCCO)cc4)cc3)CC2)CC1 |
| InChI | InChI=1S/C39H54O8/c1-2-3-5-8-29-10-12-30(13-11-29)31-14-16-32(17-15-31)38(42)46-35-22-24-36(25-23-35)47-39(43)33-18-20-34(21-19-33)44-27-28-45-37(41)9-6-4-7-26-40/h18-25,29-32,40H,2-17,26-28H2,1H3 |
| InChIKey | KJDVUDXYVQBLBE-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.85 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|