C27H29F7O2 — CID 90936715
5-[2-[difluoro-[4-(4-pent-3-enylcyclohexyl)phenyl]methoxy]ethyl]-1,3-difluoro-2-(trifluoromethoxy)benzene (PubChem CID 90936715) has the molecular formula C27H29F7O2 and a molecular weight of 518.51 g/mol. Its IUPAC name is 5-[2-[difluoro-[4-(4-pent-3-enylcyclohexyl)phenyl]methoxy]ethyl]-1,3-difluoro-2-(trifluoromethoxy)benzene.
| Compound Name | 5-[2-[difluoro-[4-(4-pent-3-enylcyclohexyl)phenyl]methoxy]ethyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 90936715 |
| Molecular Formula | C27H29F7O2 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | 5-[2-[difluoro-[4-(4-pent-3-enylcyclohexyl)phenyl]methoxy]ethyl]-1,3-difluoro-2-(trifluoromethoxy)benzene |
| SMILES | CC=CCCC1CCC(c2ccc(C(F)(F)OCCc3cc(F)c(OC(F)(F)F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C27H29F7O2/c1-2-3-4-5-18-6-8-20(9-7-18)21-10-12-22(13-11-21)26(30,31)35-15-14-19-16-23(28)25(24(29)17-19)36-27(32,33)34/h2-3,10-13,16-18,20H,4-9,14-15H2,1H3 |
| InChIKey | KGAKXVHSYHVJIY-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|