C24H20F2O3 — CID 139858223
2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane (PubChem CID 139858223) has the molecular formula C24H20F2O3 and a molecular weight of 394.42 g/mol. Its IUPAC name is 2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane.
| Compound Name | 2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 139858223 |
| Molecular Formula | C24H20F2O3 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[3-fluoro-4-[2-(6-fluoronaphthalen-2-yl)ethynyl]phenyl]-5-(methoxymethyl)-1,3-dioxane |
| SMILES | COCC1COC(c2ccc(C#Cc3ccc4cc(F)ccc4c3)c(F)c2)OC1 |
| InChI | InChI=1S/C24H20F2O3/c1-27-13-17-14-28-24(29-15-17)21-7-6-18(23(26)12-21)4-2-16-3-5-20-11-22(25)9-8-19(20)10-16/h3,5-12,17,24H,13-15H2,1H3 |
| InChIKey | USIXHNUIWSAJPN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|