C24H21F5O — CID 173325915
2-(4-butylphenyl)-3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]phenol (PubChem CID 173325915) has the molecular formula C24H21F5O and a molecular weight of 420.42 g/mol. Its IUPAC name is 2-(4-butylphenyl)-3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]phenol.
| Compound Name | 2-(4-butylphenyl)-3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]phenol |
|---|---|
| PubChem CID | 173325915 |
| Molecular Formula | C24H21F5O |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-(4-butylphenyl)-3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethyl]phenol |
| SMILES | CCCCc1ccc(-c2c(O)cc(F)c(CCc3cc(F)c(F)c(F)c3)c2F)cc1 |
| InChI | InChI=1S/C24H21F5O/c1-2-3-4-14-5-8-16(9-6-14)22-21(30)13-18(25)17(23(22)28)10-7-15-11-19(26)24(29)20(27)12-15/h5-6,8-9,11-13,30H,2-4,7,10H2,1H3 |
| InChIKey | ABUNSDLIWMZOGA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|