C27H29F3O — CID 139849922
6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-8-fluoronaphthalen-2-ol (PubChem CID 139849922) has the molecular formula C27H29F3O and a molecular weight of 426.52 g/mol. Its IUPAC name is 6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-8-fluoronaphthalen-2-ol.
| Compound Name | 6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-8-fluoronaphthalen-2-ol |
|---|---|
| PubChem CID | 139849922 |
| Molecular Formula | C27H29F3O |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 6-[2,6-difluoro-4-(4-pentylcyclohexyl)phenyl]-8-fluoronaphthalen-2-ol |
| SMILES | CCCCCC1CCC(c2cc(F)c(-c3cc(F)c4cc(O)ccc4c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H29F3O/c1-2-3-4-5-17-6-8-18(9-7-17)20-13-25(29)27(26(30)14-20)21-12-19-10-11-22(31)16-23(19)24(28)15-21/h10-18,31H,2-9H2,1H3 |
| InChIKey | YTWJSQJKFJOYPX-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|