C27H31F7 — CID 139748561
2-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methyl]-1,3-difluoro-5-(4-heptylcyclohexyl)benzene (PubChem CID 139748561) has the molecular formula C27H31F7 and a molecular weight of 488.53 g/mol. Its IUPAC name is 2-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methyl]-1,3-difluoro-5-(4-heptylcyclohexyl)benzene.
| Compound Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methyl]-1,3-difluoro-5-(4-heptylcyclohexyl)benzene |
|---|---|
| PubChem CID | 139748561 |
| Molecular Formula | C27H31F7 |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-[[3,5-difluoro-4-(trifluoromethyl)phenyl]methyl]-1,3-difluoro-5-(4-heptylcyclohexyl)benzene |
| SMILES | CCCCCCCC1CCC(c2cc(F)c(Cc3cc(F)c(C(F)(F)F)c(F)c3)c(F)c2)CC1 |
| InChI | InChI=1S/C27H31F7/c1-2-3-4-5-6-7-17-8-10-19(11-9-17)20-15-22(28)21(23(29)16-20)12-18-13-24(30)26(25(31)14-18)27(32,33)34/h13-17,19H,2-12H2,1H3 |
| InChIKey | NUDLWTVUQLPABZ-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|