C28H41F5 — CID 67748327
1,3-difluoro-5-[4-[4-(1-pentylcyclohexyl)butyl]cyclohexyl]-2-(trifluoromethyl)benzene (PubChem CID 67748327) has the molecular formula C28H41F5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 1,3-difluoro-5-[4-[4-(1-pentylcyclohexyl)butyl]cyclohexyl]-2-(trifluoromethyl)benzene.
| Compound Name | 1,3-difluoro-5-[4-[4-(1-pentylcyclohexyl)butyl]cyclohexyl]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 67748327 |
| Molecular Formula | C28H41F5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.31 |
| IUPAC Name | 1,3-difluoro-5-[4-[4-(1-pentylcyclohexyl)butyl]cyclohexyl]-2-(trifluoromethyl)benzene |
| SMILES | CCCCCC1(CCCCC2CCC(c3cc(F)c(C(F)(F)F)c(F)c3)CC2)CCCCC1 |
| InChI | InChI=1S/C28H41F5/c1-2-3-6-15-27(16-7-4-8-17-27)18-9-5-10-21-11-13-22(14-12-21)23-19-24(29)26(25(30)20-23)28(31,32)33/h19-22H,2-18H2,1H3 |
| InChIKey | GBPBEHFXFDVRRB-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|