C36H40F6O — CID 59328306
5-[4-[4-[difluoro-[2-fluoro-4-(4-pentylphenyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-1,2,3-trifluorobenzene (PubChem CID 59328306) has the molecular formula C36H40F6O and a molecular weight of 602.70 g/mol. Its IUPAC name is 5-[4-[4-[difluoro-[2-fluoro-4-(4-pentylphenyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-1,2,3-trifluorobenzene.
| Compound Name | 5-[4-[4-[difluoro-[2-fluoro-4-(4-pentylphenyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-1,2,3-trifluorobenzene |
|---|---|
| PubChem CID | 59328306 |
| Molecular Formula | C36H40F6O |
| Molecular Weight | 602.70 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | 5-[4-[4-[difluoro-[2-fluoro-4-(4-pentylphenyl)phenyl]methoxy]cyclohexyl]cyclohexyl]-1,2,3-trifluorobenzene |
| SMILES | CCCCCc1ccc(-c2ccc(C(F)(F)OC3CCC(C4CCC(c5cc(F)c(F)c(F)c5)CC4)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C36H40F6O/c1-2-3-4-5-23-6-8-26(9-7-23)28-16-19-31(32(37)20-28)36(41,42)43-30-17-14-25(15-18-30)24-10-12-27(13-11-24)29-21-33(38)35(40)34(39)22-29/h6-9,16,19-22,24-25,27,30H,2-5,10-15,17-18H2,1H3 |
| InChIKey | OETGLVUFRWHJEP-UHFFFAOYSA-N |
| XLogP | 11.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.70 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|