C23H17F5O2S — CID 134447938
2-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluoro-2-methylphenyl)phenyl]phenyl]-1,3-dioxane-5-thiol (PubChem CID 134447938) has the molecular formula C23H17F5O2S and a molecular weight of 452.44 g/mol. Its IUPAC name is 2-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluoro-2-methylphenyl)phenyl]phenyl]-1,3-dioxane-5-thiol.
| Compound Name | 2-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluoro-2-methylphenyl)phenyl]phenyl]-1,3-dioxane-5-thiol |
|---|---|
| PubChem CID | 134447938 |
| Molecular Formula | C23H17F5O2S |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | 2-[3-fluoro-4-[3-fluoro-4-(3,4,5-trifluoro-2-methylphenyl)phenyl]phenyl]-1,3-dioxane-5-thiol |
| SMILES | Cc1c(-c2ccc(-c3ccc(C4OCC(S)CO4)cc3F)cc2F)cc(F)c(F)c1F |
| InChI | InChI=1S/C23H17F5O2S/c1-11-17(8-20(26)22(28)21(11)27)16-5-2-12(6-19(16)25)15-4-3-13(7-18(15)24)23-29-9-14(31)10-30-23/h2-8,14,23,31H,9-10H2,1H3 |
| InChIKey | LVBDBMJGFPETDG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|