C22H23F3O3 — CID 139780654
2-(4-pent-4-enylphenyl)-5-[4-(trifluoromethoxy)phenyl]-1,3-dioxane (PubChem CID 139780654) has the molecular formula C22H23F3O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-(4-pent-4-enylphenyl)-5-[4-(trifluoromethoxy)phenyl]-1,3-dioxane.
| Compound Name | 2-(4-pent-4-enylphenyl)-5-[4-(trifluoromethoxy)phenyl]-1,3-dioxane |
|---|---|
| PubChem CID | 139780654 |
| Molecular Formula | C22H23F3O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 2-(4-pent-4-enylphenyl)-5-[4-(trifluoromethoxy)phenyl]-1,3-dioxane |
| SMILES | C=CCCCc1ccc(C2OCC(c3ccc(OC(F)(F)F)cc3)CO2)cc1 |
| InChI | InChI=1S/C22H23F3O3/c1-2-3-4-5-16-6-8-18(9-7-16)21-26-14-19(15-27-21)17-10-12-20(13-11-17)28-22(23,24)25/h2,6-13,19,21H,1,3-5,14-15H2 |
| InChIKey | RYBXLEGLGMHXOP-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|