C20H16F4O — CID 139750900
2-fluoro-4-[2-(4-pent-4-enylphenyl)ethynyl]-1-(trifluoromethoxy)benzene (PubChem CID 139750900) has the molecular formula C20H16F4O and a molecular weight of 348.34 g/mol. Its IUPAC name is 2-fluoro-4-[2-(4-pent-4-enylphenyl)ethynyl]-1-(trifluoromethoxy)benzene.
| Compound Name | 2-fluoro-4-[2-(4-pent-4-enylphenyl)ethynyl]-1-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 139750900 |
| Molecular Formula | C20H16F4O |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 2-fluoro-4-[2-(4-pent-4-enylphenyl)ethynyl]-1-(trifluoromethoxy)benzene |
| SMILES | C=CCCCc1ccc(C#Cc2ccc(OC(F)(F)F)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16F4O/c1-2-3-4-5-15-6-8-16(9-7-15)10-11-17-12-13-19(18(21)14-17)25-20(22,23)24/h2,6-9,12-14H,1,3-5H2 |
| InChIKey | UPFHGSCGSQCLTR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|