C29H21F3O — CID 59872018
1,4-bis[2-(4-prop-2-enylphenyl)ethynyl]-2-(trifluoromethoxy)benzene (PubChem CID 59872018) has the molecular formula C29H21F3O and a molecular weight of 442.48 g/mol. Its IUPAC name is 1,4-bis[2-(4-prop-2-enylphenyl)ethynyl]-2-(trifluoromethoxy)benzene.
| Compound Name | 1,4-bis[2-(4-prop-2-enylphenyl)ethynyl]-2-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 59872018 |
| Molecular Formula | C29H21F3O |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 1,4-bis[2-(4-prop-2-enylphenyl)ethynyl]-2-(trifluoromethoxy)benzene |
| SMILES | C=CCc1ccc(C#Cc2ccc(C#Cc3ccc(CC=C)cc3)c(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C29H21F3O/c1-3-5-22-7-11-24(12-8-22)15-16-26-18-20-27(28(21-26)33-29(30,31)32)19-17-25-13-9-23(6-4-2)10-14-25/h3-4,7-14,18,20-21H,1-2,5-6H2 |
| InChIKey | OTJAISYSZDRTDW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|