C20H20F5NO3 — CID 134561152
1-[2-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3-dioxan-5-yl]propan-1-amine (PubChem CID 134561152) has the molecular formula C20H20F5NO3 and a molecular weight of 417.37 g/mol. Its IUPAC name is 1-[2-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3-dioxan-5-yl]propan-1-amine.
| Compound Name | 1-[2-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3-dioxan-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 134561152 |
| Molecular Formula | C20H20F5NO3 |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-[2-[3,5-difluoro-4-[(3,4,5-trifluorophenyl)methoxy]phenyl]-1,3-dioxan-5-yl]propan-1-amine |
| SMILES | CCC(N)C1COC(c2cc(F)c(OCc3cc(F)c(F)c(F)c3)c(F)c2)OC1 |
| InChI | InChI=1S/C20H20F5NO3/c1-2-17(26)12-8-28-20(29-9-12)11-5-15(23)19(16(24)6-11)27-7-10-3-13(21)18(25)14(22)4-10/h3-6,12,17,20H,2,7-9,26H2,1H3 |
| InChIKey | YQBFIKUPZCEBME-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|