C36H28F8O3 — CID 59329958
2-[4-[2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]ethynyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane (PubChem CID 59329958) has the molecular formula C36H28F8O3 and a molecular weight of 660.60 g/mol. Its IUPAC name is 2-[4-[2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]ethynyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[4-[2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]ethynyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 59329958 |
| Molecular Formula | C36H28F8O3 |
| Molecular Weight | 660.60 g/mol |
| Exact Mass | 660.19 |
| IUPAC Name | 2-[4-[2-[4-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-3,5-difluorophenyl]phenyl]ethynyl]-3-fluorophenyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(c2ccc(C#Cc3ccc(-c4cc(F)c(C(F)(F)Oc5cc(F)c(F)c(F)c5)c(F)c4)cc3)c(F)c2)OC1 |
| InChI | InChI=1S/C36H28F8O3/c1-2-3-4-5-22-19-45-35(46-20-22)25-13-12-24(28(37)14-25)11-8-21-6-9-23(10-7-21)26-15-29(38)33(30(39)16-26)36(43,44)47-27-17-31(40)34(42)32(41)18-27/h6-7,9-10,12-18,22,35H,2-5,19-20H2,1H3 |
| InChIKey | OICHCRWRMSLGHS-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.60 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|