C31H19F11O — CID 129036281
5-butyl-2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-1,3-difluorobenzene (PubChem CID 129036281) has the molecular formula C31H19F11O and a molecular weight of 616.47 g/mol. Its IUPAC name is 5-butyl-2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-1,3-difluorobenzene.
| Compound Name | 5-butyl-2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
|---|---|
| PubChem CID | 129036281 |
| Molecular Formula | C31H19F11O |
| Molecular Weight | 616.47 g/mol |
| Exact Mass | 616.13 |
| IUPAC Name | 5-butyl-2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorophenyl]-1,3-difluorobenzene |
| SMILES | CCCCc1cc(F)c(-c2cc(F)c(C(F)(F)OC3=CC(F)C(C#Cc4cc(F)c(F)c(F)c4)C(F)=C3)c(F)c2)c(F)c1 |
| InChI | InChI=1S/C31H19F11O/c1-2-3-4-15-7-22(34)28(23(35)8-15)17-11-24(36)29(25(37)12-17)31(41,42)43-18-13-20(32)19(21(33)14-18)6-5-16-9-26(38)30(40)27(39)10-16/h7-14,19-20H,2-4H2,1H3 |
| InChIKey | FWEZWYSKMOTXEV-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.47 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|