C32H22F9NO2 — CID 129036852
5-butoxy-2-[2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorocyclohexa-1,5-dien-1-yl]ethynyl]pyridine (PubChem CID 129036852) has the molecular formula C32H22F9NO2 and a molecular weight of 623.52 g/mol. Its IUPAC name is 5-butoxy-2-[2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorocyclohexa-1,5-dien-1-yl]ethynyl]pyridine.
| Compound Name | 5-butoxy-2-[2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorocyclohexa-1,5-dien-1-yl]ethynyl]pyridine |
|---|---|
| PubChem CID | 129036852 |
| Molecular Formula | C32H22F9NO2 |
| Molecular Weight | 623.52 g/mol |
| Exact Mass | 623.15 |
| IUPAC Name | 5-butoxy-2-[2-[4-[[3,5-difluoro-4-[2-(3,4,5-trifluorophenyl)ethynyl]cyclohexa-1,5-dien-1-yl]oxy-difluoromethyl]-3,5-difluorocyclohexa-1,5-dien-1-yl]ethynyl]pyridine |
| SMILES | CCCCOc1ccc(C#CC2=CC(F)C(C(F)(F)OC3=CC(F)C(C#Cc4cc(F)c(F)c(F)c4)C(F)=C3)C(F)=C2)nc1 |
| InChI | InChI=1S/C32H22F9NO2/c1-2-3-10-43-21-8-7-20(42-17-21)6-4-18-11-26(35)30(27(36)12-18)32(40,41)44-22-15-24(33)23(25(34)16-22)9-5-19-13-28(37)31(39)29(38)14-19/h7-8,11-17,23-24,26,30H,2-3,10H2,1H3 |
| InChIKey | ZOFLLSBLXXIDFN-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.52 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|