C26H20Br2O2 — CID 59356855
1,4-dibromo-2,5-bis[2-(4-methoxyphenyl)ethynyl]-3,6-dimethylbenzene (PubChem CID 59356855) has the molecular formula C26H20Br2O2 and a molecular weight of 524.25 g/mol. Its IUPAC name is 1,4-dibromo-2,5-bis[2-(4-methoxyphenyl)ethynyl]-3,6-dimethylbenzene.
| Compound Name | 1,4-dibromo-2,5-bis[2-(4-methoxyphenyl)ethynyl]-3,6-dimethylbenzene |
|---|---|
| PubChem CID | 59356855 |
| Molecular Formula | C26H20Br2O2 |
| Molecular Weight | 524.25 g/mol |
| Exact Mass | 521.98 |
| IUPAC Name | 1,4-dibromo-2,5-bis[2-(4-methoxyphenyl)ethynyl]-3,6-dimethylbenzene |
| SMILES | COc1ccc(C#Cc2c(C)c(Br)c(C#Cc3ccc(OC)cc3)c(C)c2Br)cc1 |
| InChI | InChI=1S/C26H20Br2O2/c1-17-23(15-9-19-5-11-21(29-3)12-6-19)26(28)18(2)24(25(17)27)16-10-20-7-13-22(30-4)14-8-20/h5-8,11-14H,1-4H3 |
| InChIKey | TYPCZXXMDWOOHJ-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.25 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|