C30H26O8 — CID 145444604
dimethyl 4-[2-(2,4-dimethoxyphenyl)ethynyl]-7-methoxy-1,3-dihydroindeno[5,6-b][1]benzofuran-2,2-dicarboxylate (PubChem CID 145444604) has the molecular formula C30H26O8 and a molecular weight of 514.53 g/mol. Its IUPAC name is dimethyl 4-[2-(2,4-dimethoxyphenyl)ethynyl]-7-methoxy-1,3-dihydroindeno[5,6-b][1]benzofuran-2,2-dicarboxylate.
| Compound Name | dimethyl 4-[2-(2,4-dimethoxyphenyl)ethynyl]-7-methoxy-1,3-dihydroindeno[5,6-b][1]benzofuran-2,2-dicarboxylate |
|---|---|
| PubChem CID | 145444604 |
| Molecular Formula | C30H26O8 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | dimethyl 4-[2-(2,4-dimethoxyphenyl)ethynyl]-7-methoxy-1,3-dihydroindeno[5,6-b][1]benzofuran-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc3oc4cc(OC)ccc4c3c(C#Cc3ccc(OC)cc3OC)c2C1 |
| InChI | InChI=1S/C30H26O8/c1-33-19-8-6-17(24(13-19)35-3)7-10-21-23-16-30(28(31)36-4,29(32)37-5)15-18(23)12-26-27(21)22-11-9-20(34-2)14-25(22)38-26/h6,8-9,11-14H,15-16H2,1-5H3 |
| InChIKey | FRCYTZSQQZQHGW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 93.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|