C17H15NO3 — CID 102314275
4-amino-8-methoxy-2,3-dihydro-1H-cyclopenta[a]xanthen-11-one (PubChem CID 102314275) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-amino-8-methoxy-2,3-dihydro-1H-cyclopenta[a]xanthen-11-one.
| Compound Name | 4-amino-8-methoxy-2,3-dihydro-1H-cyclopenta[a]xanthen-11-one |
|---|---|
| PubChem CID | 102314275 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 4-amino-8-methoxy-2,3-dihydro-1H-cyclopenta[a]xanthen-11-one |
| SMILES | COc1ccc2c(=O)c3c4c(c(N)cc3oc2c1)CCC4 |
| InChI | InChI=1S/C17H15NO3/c1-20-9-5-6-12-14(7-9)21-15-8-13(18)10-3-2-4-11(10)16(15)17(12)19/h5-8H,2-4,18H2,1H3 |
| InChIKey | VZCYQKRMCPSTGU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|