C25H27NO5 — CID 102348070
methyl (13aS)-3,5,6-trimethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine-13a-carboxylate (PubChem CID 102348070) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is methyl (13aS)-3,5,6-trimethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine-13a-carboxylate.
| Compound Name | methyl (13aS)-3,5,6-trimethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine-13a-carboxylate |
|---|---|
| PubChem CID | 102348070 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | methyl (13aS)-3,5,6-trimethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizine-13a-carboxylate |
| SMILES | COC(=O)[C@@]12CCCN1Cc1c(c3ccc(OC)cc3c3c(OC)c(OC)ccc13)C2 |
| InChI | InChI=1S/C25H27NO5/c1-28-15-6-7-16-18(12-15)22-17(8-9-21(29-2)23(22)30-3)20-14-26-11-5-10-25(26,13-19(16)20)24(27)31-4/h6-9,12H,5,10-11,13-14H2,1-4H3/t25-/m0/s1 |
| InChIKey | NBLQRLQEJBRORM-VWLOTQADSA-N |
| XLogP | 4.08 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|