C28H34N2O4 — CID 57395709
N-[(13aS,14S)-2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-yl]-2,2-dimethylpropanamide (PubChem CID 57395709) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-[(13aS,14S)-2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(13aS,14S)-2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 57395709 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[(13aS,14S)-2,3,6-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc2c3c(c4cc(OC)c(OC)cc4c2c1)[C@H](NC(=O)C(C)(C)C)[C@@H]1CCCN1C3 |
| InChI | InChI=1S/C28H34N2O4/c1-28(2,3)27(31)29-26-22-8-7-11-30(22)15-21-17-10-9-16(32-4)12-18(17)19-13-23(33-5)24(34-6)14-20(19)25(21)26/h9-10,12-14,22,26H,7-8,11,15H2,1-6H3,(H,29,31)/t22-,26+/m0/s1 |
| InChIKey | COZXUAWZBMHRDO-BKMJKUGQSA-N |
| XLogP | 5.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|