C23H25NO5 — CID 162855524
3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine-4,14-diol (PubChem CID 162855524) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine-4,14-diol.
| Compound Name | 3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine-4,14-diol |
|---|---|
| PubChem CID | 162855524 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizine-4,14-diol |
| SMILES | COc1cc2c3c(c4ccc(OC)c(O)c4c2cc1OC)C(O)C1CCCN1C3 |
| InChI | InChI=1S/C23H25NO5/c1-27-17-7-6-12-20(23(17)26)14-10-19(29-3)18(28-2)9-13(14)15-11-24-8-4-5-16(24)22(25)21(12)15/h6-7,9-10,16,22,25-26H,4-5,8,11H2,1-3H3 |
| InChIKey | HMWZRDCCBKOTQZ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|