C27H34N2O3 — CID 123881757
N-butyl-3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-amine (PubChem CID 123881757) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is N-butyl-3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-amine.
| Compound Name | N-butyl-3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-amine |
|---|---|
| PubChem CID | 123881757 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | N-butyl-3,6,7-trimethoxy-9,11,12,13,13a,14-hexahydrophenanthro[9,10-f]indolizin-14-amine |
| SMILES | CCCCNC1c2c(c3cc(OC)c(OC)cc3c3cc(OC)ccc23)CN2CCCC12 |
| InChI | InChI=1S/C27H34N2O3/c1-5-6-11-28-27-23-8-7-12-29(23)16-22-21-15-25(32-4)24(31-3)14-20(21)19-13-17(30-2)9-10-18(19)26(22)27/h9-10,13-15,23,27-28H,5-8,11-12,16H2,1-4H3 |
| InChIKey | LBCUMVZQBBHDTJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|