C32H35N3O5 — CID 123407114
N-[[(2,3,6,7-tetramethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-13a-yl)amino]methyl]benzamide (PubChem CID 123407114) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is N-[[(2,3,6,7-tetramethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-13a-yl)amino]methyl]benzamide.
| Compound Name | N-[[(2,3,6,7-tetramethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-13a-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 123407114 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | N-[[(2,3,6,7-tetramethoxy-11,12,13,14-tetrahydro-9H-phenanthro[9,10-f]indolizin-13a-yl)amino]methyl]benzamide |
| SMILES | COc1cc2c3c(c4cc(OC)c(OC)cc4c2cc1OC)CC1(NCNC(=O)c2ccccc2)CCCN1C3 |
| InChI | InChI=1S/C32H35N3O5/c1-37-27-13-21-22-14-28(38-2)30(40-4)16-24(22)26-18-35-12-8-11-32(35,17-25(26)23(21)15-29(27)39-3)34-19-33-31(36)20-9-6-5-7-10-20/h5-7,9-10,13-16,34H,8,11-12,17-19H2,1-4H3,(H,33,36) |
| InChIKey | KXQWHCQMVTXYHX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|