C20H29FN2O2 — CID 17446987
3-fluoro-4-methoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide (PubChem CID 17446987) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 17446987 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC2(N3CCCCC3)CCCCC2)cc1F |
| InChI | InChI=1S/C20H29FN2O2/c1-25-18-9-8-16(14-17(18)21)19(24)22-15-20(10-4-2-5-11-20)23-12-6-3-7-13-23/h8-9,14H,2-7,10-13,15H2,1H3,(H,22,24) |
| InChIKey | PDSQRJYJYRGHCR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |