C22H34N2O4 — CID 2449625
2,3,4-trimethoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide (PubChem CID 2449625) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 2449625 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | 2,3,4-trimethoxy-N-[(1-piperidin-1-ylcyclohexyl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC2(N3CCCCC3)CCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C22H34N2O4/c1-26-18-11-10-17(19(27-2)20(18)28-3)21(25)23-16-22(12-6-4-7-13-22)24-14-8-5-9-15-24/h10-11H,4-9,12-16H2,1-3H3,(H,23,25) |
| InChIKey | KIJMOPYYLYSVEF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |