C17H21FN2O2 — CID 167885147
4-fluoro-3-methoxy-N-(2,3,5,8-tetrahydro-1H-indolizin-8a-ylmethyl)benzamide (PubChem CID 167885147) has the molecular formula C17H21FN2O2 and a molecular weight of 304.37 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-(2,3,5,8-tetrahydro-1H-indolizin-8a-ylmethyl)benzamide.
| Compound Name | 4-fluoro-3-methoxy-N-(2,3,5,8-tetrahydro-1H-indolizin-8a-ylmethyl)benzamide |
|---|---|
| PubChem CID | 167885147 |
| Molecular Formula | C17H21FN2O2 |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-fluoro-3-methoxy-N-(2,3,5,8-tetrahydro-1H-indolizin-8a-ylmethyl)benzamide |
| SMILES | COc1cc(C(=O)NCC23CC=CCN2CCC3)ccc1F |
| InChI | InChI=1S/C17H21FN2O2/c1-22-15-11-13(5-6-14(15)18)16(21)19-12-17-7-2-3-9-20(17)10-4-8-17/h2-3,5-6,11H,4,7-10,12H2,1H3,(H,19,21) |
| InChIKey | AMOKQYBSZPSVBO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|