C16H23FN2O5S — CID 146075050
3-fluoro-4-methoxy-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]benzamide (PubChem CID 146075050) has the molecular formula C16H23FN2O5S and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-fluoro-4-methoxy-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]benzamide.
| Compound Name | 3-fluoro-4-methoxy-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 146075050 |
| Molecular Formula | C16H23FN2O5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 3-fluoro-4-methoxy-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC2(OC)CCN(S(C)(=O)=O)CC2)cc1F |
| InChI | InChI=1S/C16H23FN2O5S/c1-23-14-5-4-12(10-13(14)17)15(20)18-11-16(24-2)6-8-19(9-7-16)25(3,21)22/h4-5,10H,6-9,11H2,1-3H3,(H,18,20) |
| InChIKey | ZOBRBIOXWAJJKU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |