C13H19BrN2O5S — CID 146075012
5-bromo-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]furan-2-carboxamide (PubChem CID 146075012) has the molecular formula C13H19BrN2O5S and a molecular weight of 395.28 g/mol. Its IUPAC name is 5-bromo-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 146075012 |
| Molecular Formula | C13H19BrN2O5S |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.02 |
| IUPAC Name | 5-bromo-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]furan-2-carboxamide |
| SMILES | COC1(CNC(=O)c2ccc(Br)o2)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C13H19BrN2O5S/c1-20-13(5-7-16(8-6-13)22(2,18)19)9-15-12(17)10-3-4-11(14)21-10/h3-4H,5-9H2,1-2H3,(H,15,17) |
| InChIKey | CPZBDSNNDVDQKN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |