C17H22N4O5S — CID 146075191
N'-(2-cyanophenyl)-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]oxamide (PubChem CID 146075191) has the molecular formula C17H22N4O5S and a molecular weight of 394.45 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]oxamide.
| Compound Name | N'-(2-cyanophenyl)-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]oxamide |
|---|---|
| PubChem CID | 146075191 |
| Molecular Formula | C17H22N4O5S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[(4-methoxy-1-methylsulfonylpiperidin-4-yl)methyl]oxamide |
| SMILES | COC1(CNC(=O)C(=O)Nc2ccccc2C#N)CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C17H22N4O5S/c1-26-17(7-9-21(10-8-17)27(2,24)25)12-19-15(22)16(23)20-14-6-4-3-5-13(14)11-18/h3-6H,7-10,12H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | DYIJLTOQXLEULP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|