C28H30N2O4 — CID 2960603
3,4-dimethoxy-N-[4-[(1-phenylcyclopentyl)methylcarbamoyl]phenyl]benzamide (PubChem CID 2960603) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[4-[(1-phenylcyclopentyl)methylcarbamoyl]phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[4-[(1-phenylcyclopentyl)methylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2960603 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3,4-dimethoxy-N-[4-[(1-phenylcyclopentyl)methylcarbamoyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(C(=O)NCC3(c4ccccc4)CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C28H30N2O4/c1-33-24-15-12-21(18-25(24)34-2)27(32)30-23-13-10-20(11-14-23)26(31)29-19-28(16-6-7-17-28)22-8-4-3-5-9-22/h3-5,8-15,18H,6-7,16-17,19H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | CFHXXYYZNWOSEP-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |