C23H26O7 — CID 101444879
dimethyl 3-acetyl-4-[(Z)-4-ethoxy-4-oxo-3-phenylbut-2-en-2-yl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101444879) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is dimethyl 3-acetyl-4-[(Z)-4-ethoxy-4-oxo-3-phenylbut-2-en-2-yl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-acetyl-4-[(Z)-4-ethoxy-4-oxo-3-phenylbut-2-en-2-yl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101444879 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | dimethyl 3-acetyl-4-[(Z)-4-ethoxy-4-oxo-3-phenylbut-2-en-2-yl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | CCOC(=O)/C(=C(/C)C1=C(C(C)=O)CC(C(=O)OC)(C(=O)OC)C1)c1ccccc1 |
| InChI | InChI=1S/C23H26O7/c1-6-30-20(25)19(16-10-8-7-9-11-16)14(2)17-12-23(21(26)28-4,22(27)29-5)13-18(17)15(3)24/h7-11H,6,12-13H2,1-5H3/b19-14- |
| InChIKey | WTMVLJNWVSYTOQ-RGEXLXHISA-N |
| XLogP | 3.04 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|