C28H33NO4 — CID 102104209
dimethyl 5-heptyl-1-(4-methylphenyl)-4-phenylpyrrole-2,3-dicarboxylate (PubChem CID 102104209) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is dimethyl 5-heptyl-1-(4-methylphenyl)-4-phenylpyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 5-heptyl-1-(4-methylphenyl)-4-phenylpyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102104209 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | dimethyl 5-heptyl-1-(4-methylphenyl)-4-phenylpyrrole-2,3-dicarboxylate |
| SMILES | CCCCCCCc1c(-c2ccccc2)c(C(=O)OC)c(C(=O)OC)n1-c1ccc(C)cc1 |
| InChI | InChI=1S/C28H33NO4/c1-5-6-7-8-12-15-23-24(21-13-10-9-11-14-21)25(27(30)32-3)26(28(31)33-4)29(23)22-18-16-20(2)17-19-22/h9-11,13-14,16-19H,5-8,12,15H2,1-4H3 |
| InChIKey | PJFOEUWCUFSJPU-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|