C29H32O4Si — CID 133188461
dimethyl 5,5-dimethyl-4-pentyl-1-phenylbenzo[b][1]benzosilole-2,3-dicarboxylate (PubChem CID 133188461) has the molecular formula C29H32O4Si and a molecular weight of 472.66 g/mol. Its IUPAC name is dimethyl 5,5-dimethyl-4-pentyl-1-phenylbenzo[b][1]benzosilole-2,3-dicarboxylate.
| Compound Name | dimethyl 5,5-dimethyl-4-pentyl-1-phenylbenzo[b][1]benzosilole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 133188461 |
| Molecular Formula | C29H32O4Si |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | dimethyl 5,5-dimethyl-4-pentyl-1-phenylbenzo[b][1]benzosilole-2,3-dicarboxylate |
| SMILES | CCCCCc1c(C(=O)OC)c(C(=O)OC)c(-c2ccccc2)c2c1[Si](C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C29H32O4Si/c1-6-7-9-17-21-25(28(30)32-2)26(29(31)33-3)23(19-14-10-8-11-15-19)24-20-16-12-13-18-22(20)34(4,5)27(21)24/h8,10-16,18H,6-7,9,17H2,1-5H3 |
| InChIKey | VEYOEFDIEHPLJJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|