C27H23NO4 — CID 122397153
dimethyl 1-(3-methylphenyl)-4,5-diphenylpyrrole-2,3-dicarboxylate (PubChem CID 122397153) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is dimethyl 1-(3-methylphenyl)-4,5-diphenylpyrrole-2,3-dicarboxylate.
| Compound Name | dimethyl 1-(3-methylphenyl)-4,5-diphenylpyrrole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 122397153 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | dimethyl 1-(3-methylphenyl)-4,5-diphenylpyrrole-2,3-dicarboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)c(-c2ccccc2)n(-c2cccc(C)c2)c1C(=O)OC |
| InChI | InChI=1S/C27H23NO4/c1-18-11-10-16-21(17-18)28-24(20-14-8-5-9-15-20)22(19-12-6-4-7-13-19)23(26(29)31-2)25(28)27(30)32-3/h4-17H,1-3H3 |
| InChIKey | HSVRHVSYRBSTRB-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |