C20H16N2O6 — CID 134839740
dimethyl 2,6-dioxo-1,3-diphenylpyrimidine-4,5-dicarboxylate (PubChem CID 134839740) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is dimethyl 2,6-dioxo-1,3-diphenylpyrimidine-4,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dioxo-1,3-diphenylpyrimidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134839740 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | dimethyl 2,6-dioxo-1,3-diphenylpyrimidine-4,5-dicarboxylate |
| SMILES | COC(=O)c1c(C(=O)OC)n(-c2ccccc2)c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C20H16N2O6/c1-27-18(24)15-16(19(25)28-2)21(13-9-5-3-6-10-13)20(26)22(17(15)23)14-11-7-4-8-12-14/h3-12H,1-2H3 |
| InChIKey | FQKDLZSMJVMPIJ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |