C16H12N2O5 — CID 10733861
dimethyl 2-cyano-6-oxo-1-phenylpyridine-3,4-dicarboxylate (PubChem CID 10733861) has the molecular formula C16H12N2O5 and a molecular weight of 312.28 g/mol. Its IUPAC name is dimethyl 2-cyano-6-oxo-1-phenylpyridine-3,4-dicarboxylate.
| Compound Name | dimethyl 2-cyano-6-oxo-1-phenylpyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 10733861 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | dimethyl 2-cyano-6-oxo-1-phenylpyridine-3,4-dicarboxylate |
| SMILES | COC(=O)c1cc(=O)n(-c2ccccc2)c(C#N)c1C(=O)OC |
| InChI | InChI=1S/C16H12N2O5/c1-22-15(20)11-8-13(19)18(10-6-4-3-5-7-10)12(9-17)14(11)16(21)23-2/h3-8H,1-2H3 |
| InChIKey | SIFDXLFOKRMWJK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 98.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |