C18H19NO4 — CID 89418834
ethyl 7-formyl-5,5-dimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylate (PubChem CID 89418834) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 7-formyl-5,5-dimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylate.
| Compound Name | ethyl 7-formyl-5,5-dimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylate |
|---|---|
| PubChem CID | 89418834 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 7-formyl-5,5-dimethyl-8-oxo-7,9-dihydro-6H-carbazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc2[nH]c3c(c2c1)C(C)(C)CC(C=O)C3=O |
| InChI | InChI=1S/C18H19NO4/c1-4-23-17(22)10-5-6-13-12(7-10)14-15(19-13)16(21)11(9-20)8-18(14,2)3/h5-7,9,11,19H,4,8H2,1-3H3 |
| InChIKey | PFDKSNZWEHPXOQ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|