About 1-bromonaphthalene;methanamine
1-bromonaphthalene;methanamine (PubChem CID 143041720) has the molecular formula C11H12BrN
and a molecular weight of 238.13 g/mol. Its IUPAC name is 1-bromonaphthalene;methanamine.
Molecular Properties
| Compound Name | 1-bromonaphthalene;methanamine |
| PubChem CID | 143041720 |
| Molecular Formula | C11H12BrN |
| Molecular Weight | 238.13 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 1-bromonaphthalene;methanamine |
| SMILES | Brc1cccc2ccccc12.CN |
| InChI | InChI=1S/C10H7Br.CH5N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H;2H2,1H3 |
| InChIKey | LGJAXWUABVTRJC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.13 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-bromonaphthalene;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromonaphthalene;methanamine?
The IUPAC name of 1-bromonaphthalene;methanamine (CID 143041720) is 1-bromonaphthalene;methanamine.
What is the SMILES notation for 1-bromonaphthalene;methanamine?
The canonical SMILES for 1-bromonaphthalene;methanamine is Brc1cccc2ccccc12.CN.
What is the InChIKey of 1-bromonaphthalene;methanamine?
The InChIKey is LGJAXWUABVTRJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Br.CH5N/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7H;2H2,1H3.
What are the key properties of 1-bromonaphthalene;methanamine?
1-bromonaphthalene;methanamine has a molecular weight of 238.13 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromonaphthalene;methanamine is sourced from PubChem (CID 143041720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).