About ethyl acetate;trimethoxy(phenyl)silane
ethyl acetate;trimethoxy(phenyl)silane (PubChem CID 175137156) has the molecular formula C13H22O5Si
and a molecular weight of 286.40 g/mol. Its IUPAC name is ethyl acetate;trimethoxy(phenyl)silane.
Molecular Properties
| Compound Name | ethyl acetate;trimethoxy(phenyl)silane |
| PubChem CID | 175137156 |
| Molecular Formula | C13H22O5Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | ethyl acetate;trimethoxy(phenyl)silane |
| SMILES | CCOC(C)=O.CO[Si](OC)(OC)c1ccccc1 |
| InChI | InChI=1S/C9H14O3Si.C4H8O2/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-3-6-4(2)5/h4-8H,1-3H3;3H2,1-2H3 |
| InChIKey | IYHVWBHNPIYOKI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl acetate;trimethoxy(phenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl acetate;trimethoxy(phenyl)silane?
The IUPAC name of ethyl acetate;trimethoxy(phenyl)silane (CID 175137156) is ethyl acetate;trimethoxy(phenyl)silane.
What is the SMILES notation for ethyl acetate;trimethoxy(phenyl)silane?
The canonical SMILES for ethyl acetate;trimethoxy(phenyl)silane is CCOC(C)=O.CO[Si](OC)(OC)c1ccccc1.
What is the InChIKey of ethyl acetate;trimethoxy(phenyl)silane?
The InChIKey is IYHVWBHNPIYOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3Si.C4H8O2/c1-10-13(11-2,12-3)9-7-5-4-6-8-9;1-3-6-4(2)5/h4-8H,1-3H3;3H2,1-2H3.
What are the key properties of ethyl acetate;trimethoxy(phenyl)silane?
ethyl acetate;trimethoxy(phenyl)silane has a molecular weight of 286.40 g/mol, XLogP of 1.34, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl acetate;trimethoxy(phenyl)silane is sourced from PubChem (CID 175137156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).