About [dimethoxy(phenyl)silyl] acetate
[dimethoxy(phenyl)silyl] acetate (PubChem CID 66889787) has the molecular formula C10H14O4Si
and a molecular weight of 226.30 g/mol. Its IUPAC name is [dimethoxy(phenyl)silyl] acetate.
Molecular Properties
| Compound Name | [dimethoxy(phenyl)silyl] acetate |
| PubChem CID | 66889787 |
| Molecular Formula | C10H14O4Si |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [dimethoxy(phenyl)silyl] acetate |
| SMILES | CO[Si](OC)(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C10H14O4Si/c1-9(11)14-15(12-2,13-3)10-7-5-4-6-8-10/h4-8H,1-3H3 |
| InChIKey | XSOBGTOVTPCHRO-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethoxy(phenyl)silyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethoxy(phenyl)silyl] acetate?
The IUPAC name of [dimethoxy(phenyl)silyl] acetate (CID 66889787) is [dimethoxy(phenyl)silyl] acetate.
What is the SMILES notation for [dimethoxy(phenyl)silyl] acetate?
The canonical SMILES for [dimethoxy(phenyl)silyl] acetate is CO[Si](OC)(OC(C)=O)c1ccccc1.
What is the InChIKey of [dimethoxy(phenyl)silyl] acetate?
The InChIKey is XSOBGTOVTPCHRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4Si/c1-9(11)14-15(12-2,13-3)10-7-5-4-6-8-10/h4-8H,1-3H3.
What are the key properties of [dimethoxy(phenyl)silyl] acetate?
[dimethoxy(phenyl)silyl] acetate has a molecular weight of 226.30 g/mol, XLogP of 0.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethoxy(phenyl)silyl] acetate is sourced from PubChem (CID 66889787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).