About [diacetyloxy(phenyl)silyl] 2-butoxyacetate
[diacetyloxy(phenyl)silyl] 2-butoxyacetate (PubChem CID 163704252) has the molecular formula C16H22O7Si
and a molecular weight of 354.43 g/mol. Its IUPAC name is [diacetyloxy(phenyl)silyl] 2-butoxyacetate.
Molecular Properties
| Compound Name | [diacetyloxy(phenyl)silyl] 2-butoxyacetate |
| PubChem CID | 163704252 |
| Molecular Formula | C16H22O7Si |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [diacetyloxy(phenyl)silyl] 2-butoxyacetate |
| SMILES | CCCCOCC(=O)O[Si](OC(C)=O)(OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O7Si/c1-4-5-11-20-12-16(19)23-24(21-13(2)17,22-14(3)18)15-9-7-6-8-10-15/h6-10H,4-5,11-12H2,1-3H3 |
| InChIKey | KDQRLRTYROFVKJ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [diacetyloxy(phenyl)silyl] 2-butoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diacetyloxy(phenyl)silyl] 2-butoxyacetate?
The IUPAC name of [diacetyloxy(phenyl)silyl] 2-butoxyacetate (CID 163704252) is [diacetyloxy(phenyl)silyl] 2-butoxyacetate.
What is the SMILES notation for [diacetyloxy(phenyl)silyl] 2-butoxyacetate?
The canonical SMILES for [diacetyloxy(phenyl)silyl] 2-butoxyacetate is CCCCOCC(=O)O[Si](OC(C)=O)(OC(C)=O)c1ccccc1.
What is the InChIKey of [diacetyloxy(phenyl)silyl] 2-butoxyacetate?
The InChIKey is KDQRLRTYROFVKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O7Si/c1-4-5-11-20-12-16(19)23-24(21-13(2)17,22-14(3)18)15-9-7-6-8-10-15/h6-10H,4-5,11-12H2,1-3H3.
What are the key properties of [diacetyloxy(phenyl)silyl] 2-butoxyacetate?
[diacetyloxy(phenyl)silyl] 2-butoxyacetate has a molecular weight of 354.43 g/mol, XLogP of 1.32, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [diacetyloxy(phenyl)silyl] 2-butoxyacetate is sourced from PubChem (CID 163704252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).