C12H10O7 — CID 71350381
ethyl 4,5,7-trihydroxy-2-oxochromene-6-carboxylate (PubChem CID 71350381) has the molecular formula C12H10O7 and a molecular weight of 266.20 g/mol. Its IUPAC name is ethyl 4,5,7-trihydroxy-2-oxochromene-6-carboxylate.
| Compound Name | ethyl 4,5,7-trihydroxy-2-oxochromene-6-carboxylate |
|---|---|
| PubChem CID | 71350381 |
| Molecular Formula | C12H10O7 |
| Molecular Weight | 266.20 g/mol |
| Exact Mass | 266.04 |
| IUPAC Name | ethyl 4,5,7-trihydroxy-2-oxochromene-6-carboxylate |
| SMILES | CCOC(=O)c1c(O)cc2oc(=O)cc(O)c2c1O |
| InChI | InChI=1S/C12H10O7/c1-2-18-12(17)10-5(13)3-7-9(11(10)16)6(14)4-8(15)19-7/h3-4,13-14,16H,2H2,1H3 |
| InChIKey | PXPLWDFHEMPLOG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|