C17H20O5 — CID 15965463
6-(3,3-dimethylbutanoyl)-4-ethyl-5,7-dihydroxychromen-2-one (PubChem CID 15965463) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 6-(3,3-dimethylbutanoyl)-4-ethyl-5,7-dihydroxychromen-2-one.
| Compound Name | 6-(3,3-dimethylbutanoyl)-4-ethyl-5,7-dihydroxychromen-2-one |
|---|---|
| PubChem CID | 15965463 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 6-(3,3-dimethylbutanoyl)-4-ethyl-5,7-dihydroxychromen-2-one |
| SMILES | CCc1cc(=O)oc2cc(O)c(C(=O)CC(C)(C)C)c(O)c12 |
| InChI | InChI=1S/C17H20O5/c1-5-9-6-13(20)22-12-7-10(18)15(16(21)14(9)12)11(19)8-17(2,3)4/h6-7,18,21H,5,8H2,1-4H3 |
| InChIKey | YLKZBBBRVRKQMG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|