C14H11NO6 — CID 70822687
ethyl 7,8-dihydroxy-1-oxo-2H-[1]benzofuro[3,2-c]pyridine-9-carboxylate (PubChem CID 70822687) has the molecular formula C14H11NO6 and a molecular weight of 289.24 g/mol. Its IUPAC name is ethyl 7,8-dihydroxy-1-oxo-2H-[1]benzofuro[3,2-c]pyridine-9-carboxylate.
| Compound Name | ethyl 7,8-dihydroxy-1-oxo-2H-[1]benzofuro[3,2-c]pyridine-9-carboxylate |
|---|---|
| PubChem CID | 70822687 |
| Molecular Formula | C14H11NO6 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | ethyl 7,8-dihydroxy-1-oxo-2H-[1]benzofuro[3,2-c]pyridine-9-carboxylate |
| SMILES | CCOC(=O)c1c(O)c(O)cc2oc3cc[nH]c(=O)c3c12 |
| InChI | InChI=1S/C14H11NO6/c1-2-20-14(19)11-9-8(5-6(16)12(11)17)21-7-3-4-15-13(18)10(7)9/h3-5,16-17H,2H2,1H3,(H,15,18) |
| InChIKey | DZZGZPUYWJYTNG-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|