C22H24O3 — CID 101381863
ethyl 4-but-3-enyl-3-hydroxy-1-methyl-9,10-dihydroanthracene-2-carboxylate (PubChem CID 101381863) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is ethyl 4-but-3-enyl-3-hydroxy-1-methyl-9,10-dihydroanthracene-2-carboxylate.
| Compound Name | ethyl 4-but-3-enyl-3-hydroxy-1-methyl-9,10-dihydroanthracene-2-carboxylate |
|---|---|
| PubChem CID | 101381863 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | ethyl 4-but-3-enyl-3-hydroxy-1-methyl-9,10-dihydroanthracene-2-carboxylate |
| SMILES | C=CCCc1c(O)c(C(=O)OCC)c(C)c2c1Cc1ccccc1C2 |
| InChI | InChI=1S/C22H24O3/c1-4-6-11-17-19-13-16-10-8-7-9-15(16)12-18(19)14(3)20(21(17)23)22(24)25-5-2/h4,7-10,23H,1,5-6,11-13H2,2-3H3 |
| InChIKey | TVXZFXIAMRTWPK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|