C19H26O3 — CID 101381866
ethyl 5-but-3-enyl-2,3,4-trimethyl-6-prop-2-enoxybenzoate (PubChem CID 101381866) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethyl 5-but-3-enyl-2,3,4-trimethyl-6-prop-2-enoxybenzoate.
| Compound Name | ethyl 5-but-3-enyl-2,3,4-trimethyl-6-prop-2-enoxybenzoate |
|---|---|
| PubChem CID | 101381866 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | ethyl 5-but-3-enyl-2,3,4-trimethyl-6-prop-2-enoxybenzoate |
| SMILES | C=CCCc1c(C)c(C)c(C)c(C(=O)OCC)c1OCC=C |
| InChI | InChI=1S/C19H26O3/c1-7-10-11-16-14(5)13(4)15(6)17(19(20)21-9-3)18(16)22-12-8-2/h7-8H,1-2,9-12H2,3-6H3 |
| InChIKey | BWTCAHIYEDGYSC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|